About 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole
2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole (PubChem CID 59459038) has the molecular formula C8H10F3NO
and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole.
Analyze 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole?
The IUPAC name of 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole (CID 59459038) is 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole.
What is the SMILES notation for 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole?
The canonical SMILES for 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole is Cc1nc(C(C)C)c(C(F)(F)F)o1.
What is the InChIKey of 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole?
The InChIKey is HKEDOVHNHMFVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO/c1-4(2)6-7(8(9,10)11)13-5(3)12-6/h4H,1-3H3.
What are the key properties of 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole?
2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole has a molecular weight of 193.17 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propan-2-yl-5-(trifluoromethyl)-1,3-oxazole is sourced from PubChem (CID 59459038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).