C34H58O5 — CID 59459709
(9E)-12-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-8-(1-hydroxyethoxy)-4,7,7,11-tetramethyl-1-oxacyclododec-9-en-2-one (PubChem CID 59459709) has the molecular formula C34H58O5 and a molecular weight of 546.83 g/mol. Its IUPAC name is (9E)-12-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-8-(1-hydroxyethoxy)-4,7,7,11-tetramethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-12-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-8-(1-hydroxyethoxy)-4,7,7,11-tetramethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 59459709 |
| Molecular Formula | C34H58O5 |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | (9E)-12-[(2E,4E)-6,6-dimethyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-8-(1-hydroxyethoxy)-4,7,7,11-tetramethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC(C)C(C)C1OC1CC(C)(C)/C=C/C=C(\C)C1OC(=O)CC(C)CCC(C)(C)C(OC(C)O)/C=C/C1C |
| InChI | InChI=1S/C34H58O5/c1-12-23(3)26(6)32-28(38-32)21-33(8,9)18-13-14-24(4)31-25(5)15-16-29(37-27(7)35)34(10,11)19-17-22(2)20-30(36)39-31/h13-16,18,22-23,25-29,31-32,35H,12,17,19-21H2,1-11H3/b16-15+,18-13+,24-14+ |
| InChIKey | CBDNGPXBLICGMZ-OEWYIGQNSA-N |
| XLogP | 8.03 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|