C64H66B2N2Pt — CID 59459816
bis(5-[2,6-di(propan-2-yl)phenyl]-7-(2,4,6-trimethylphenyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) (PubChem CID 59459816) has the molecular formula C64H66B2N2Pt and a molecular weight of 1079.95 g/mol. Its IUPAC name is bis(5-[2,6-di(propan-2-yl)phenyl]-7-(2,4,6-trimethylphenyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+).
| Compound Name | bis(5-[2,6-di(propan-2-yl)phenyl]-7-(2,4,6-trimethylphenyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) |
|---|---|
| PubChem CID | 59459816 |
| Molecular Formula | C64H66B2N2Pt |
| Molecular Weight | 1079.95 g/mol |
| Exact Mass | 1079.51 |
| IUPAC Name | bis(5-[2,6-di(propan-2-yl)phenyl]-7-(2,4,6-trimethylphenyl)-9H-[1]benzoborolo[3,2-b]pyridin-9-ide);platinum(2+) |
| SMILES | Cc1cc(C)c(-c2c[c-]c3c(c2)B(c2c(C(C)C)cccc2C(C)C)c2cccnc2-3)c(C)c1.Cc1cc(C)c(-c2c[c-]c3c(c2)B(c2c(C(C)C)cccc2C(C)C)c2cccnc2-3)c(C)c1.[Pt+2] |
| InChI | InChI=1S/2C32H33BN.Pt/c2*1-19(2)25-10-8-11-26(20(3)4)31(25)33-28-12-9-15-34-32(28)27-14-13-24(18-29(27)33)30-22(6)16-21(5)17-23(30)7;/h2*8-13,15-20H,1-7H3;/q2*-1;+2 |
| InChIKey | NDDLEJYRGUIBMJ-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.95 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|