C19H27ClN4O — CID 59463575
1-[(9aS)-6-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone (PubChem CID 59463575) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is 1-[(9aS)-6-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone.
| Compound Name | 1-[(9aS)-6-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
|---|---|
| PubChem CID | 59463575 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-[(9aS)-6-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
| SMILES | CC1CCC[C@H]2CN(C(=O)CN3CCc4nc(Cl)ccc4C3)CCN12 |
| InChI | InChI=1S/C19H27ClN4O/c1-14-3-2-4-16-12-23(9-10-24(14)16)19(25)13-22-8-7-17-15(11-22)5-6-18(20)21-17/h5-6,14,16H,2-4,7-13H2,1H3/t14?,16-/m0/s1 |
| InChIKey | CSDVXOWLEWIFDZ-WMCAAGNKSA-N |
| XLogP | 2.18 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|