C12H15ClN2O2 — CID 176891153
2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethyl acetate (PubChem CID 176891153) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethyl acetate.
| Compound Name | 2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethyl acetate |
|---|---|
| PubChem CID | 176891153 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethyl acetate |
| SMILES | CC(=O)OCCN1CCc2nc(Cl)ccc2C1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-9(16)17-7-6-15-5-4-11-10(8-15)2-3-12(13)14-11/h2-3H,4-8H2,1H3 |
| InChIKey | LGCZEMWJJIOAKX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|