C14H17BrO — CID 59463798
3-bromo-2,5-di(propan-2-yl)-1-benzofuran (PubChem CID 59463798) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is 3-bromo-2,5-di(propan-2-yl)-1-benzofuran.
| Compound Name | 3-bromo-2,5-di(propan-2-yl)-1-benzofuran |
|---|---|
| PubChem CID | 59463798 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-bromo-2,5-di(propan-2-yl)-1-benzofuran |
| SMILES | CC(C)c1ccc2oc(C(C)C)c(Br)c2c1 |
| InChI | InChI=1S/C14H17BrO/c1-8(2)10-5-6-12-11(7-10)13(15)14(16-12)9(3)4/h5-9H,1-4H3 |
| InChIKey | ORCFTUDDIJVNED-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |