About 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran
9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran (PubChem CID 154595903) has the molecular formula C19H15BrO
and a molecular weight of 339.23 g/mol. Its IUPAC name is 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran.
Molecular Properties
| Compound Name | 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran |
| PubChem CID | 154595903 |
| Molecular Formula | C19H15BrO |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran |
| SMILES | CC(C)c1ccc2ccc3c4ccc(Br)cc4oc3c2c1 |
| InChI | InChI=1S/C19H15BrO/c1-11(2)13-4-3-12-5-7-16-15-8-6-14(20)10-18(15)21-19(16)17(12)9-13/h3-11H,1-2H3 |
| InChIKey | BGTWLKQQLSVUMT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran?
The IUPAC name of 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran (CID 154595903) is 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran.
What is the SMILES notation for 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran?
The canonical SMILES for 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran is CC(C)c1ccc2ccc3c4ccc(Br)cc4oc3c2c1.
What is the InChIKey of 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran?
The InChIKey is BGTWLKQQLSVUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrO/c1-11(2)13-4-3-12-5-7-16-15-8-6-14(20)10-18(15)21-19(16)17(12)9-13/h3-11H,1-2H3.
What are the key properties of 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran?
9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran has a molecular weight of 339.23 g/mol, XLogP of 6.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-2-propan-2-ylnaphtho[1,2-b][1]benzofuran is sourced from PubChem (CID 154595903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).