C16H23N5O4 — CID 59464211
methyl 2-[1-[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]-4-methylpiperidin-4-yl]acetate (PubChem CID 59464211) has the molecular formula C16H23N5O4 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 2-[1-[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]-4-methylpiperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]-4-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 59464211 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | methyl 2-[1-[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]-4-methylpiperidin-4-yl]acetate |
| SMILES | COC(=O)CC1(C)CCN(c2ccc(NC(=O)C(=O)NN)cn2)CC1 |
| InChI | InChI=1S/C16H23N5O4/c1-16(9-13(22)25-2)5-7-21(8-6-16)12-4-3-11(10-18-12)19-14(23)15(24)20-17/h3-4,10H,5-9,17H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | PNKCZRHZPPBIDH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|