C16H22N4O5 — CID 67087473
methyl 2-[4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexyl]acetate (PubChem CID 67087473) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is methyl 2-[4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexyl]acetate |
|---|---|
| PubChem CID | 67087473 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl 2-[4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(Oc2ccc(NC(=O)C(=O)NN)cn2)CC1 |
| InChI | InChI=1S/C16H22N4O5/c1-24-14(21)8-10-2-5-12(6-3-10)25-13-7-4-11(9-18-13)19-15(22)16(23)20-17/h4,7,9-10,12H,2-3,5-6,8,17H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | AEYIGPAVABMYAO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|