C16H20N2O5 — CID 143766436
methyl 4-[[5-(2-oxopropanoylamino)-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 143766436) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 4-[[5-(2-oxopropanoylamino)-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[5-(2-oxopropanoylamino)-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 143766436 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 4-[[5-(2-oxopropanoylamino)-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Oc2ccc(NC(=O)C(C)=O)cn2)CC1 |
| InChI | InChI=1S/C16H20N2O5/c1-10(19)15(20)18-12-5-8-14(17-9-12)23-13-6-3-11(4-7-13)16(21)22-2/h5,8-9,11,13H,3-4,6-7H2,1-2H3,(H,18,20) |
| InChIKey | DOYXHFCNIGOKLJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|