C17H23N3O6 — CID 58231026
methyl 4-[[5-[(3-amino-2-oxopropanoyl)amino]-3-methoxy-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 58231026) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 4-[[5-[(3-amino-2-oxopropanoyl)amino]-3-methoxy-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[5-[(3-amino-2-oxopropanoyl)amino]-3-methoxy-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58231026 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | methyl 4-[[5-[(3-amino-2-oxopropanoyl)amino]-3-methoxy-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Oc2ncc(NC(=O)C(=O)CN)cc2OC)CC1 |
| InChI | InChI=1S/C17H23N3O6/c1-24-14-7-11(20-15(22)13(21)8-18)9-19-16(14)26-12-5-3-10(4-6-12)17(23)25-2/h7,9-10,12H,3-6,8,18H2,1-2H3,(H,20,22) |
| InChIKey | CBDNWFOMEISYQH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|