C14H18N4O5 — CID 67087499
methyl 3-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclopentane-1-carboxylate (PubChem CID 67087499) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is methyl 3-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 67087499 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | methyl 3-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Oc2ccc(NC(=O)C(=O)NN)cn2)C1 |
| InChI | InChI=1S/C14H18N4O5/c1-22-14(21)8-2-4-10(6-8)23-11-5-3-9(7-16-11)17-12(19)13(20)18-15/h3,5,7-8,10H,2,4,6,15H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | FAFDODMUBMYMCZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|