C18H26N4O5 — CID 67087770
tert-butyl 4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 67087770) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is tert-butyl 4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67087770 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | tert-butyl 4-[[5-[(2-hydrazinyl-2-oxoacetyl)amino]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(Oc2ccc(NC(=O)C(=O)NN)cn2)CC1 |
| InChI | InChI=1S/C18H26N4O5/c1-18(2,3)27-17(25)11-4-7-13(8-5-11)26-14-9-6-12(10-20-14)21-15(23)16(24)22-19/h6,9-11,13H,4-5,7-8,19H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | AAJUTWFXLBBZOP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|