C22H33N3O6 — CID 66761492
ethyl 4-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 66761492) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl 4-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66761492 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl 4-[[5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(C(=O)NCCNC(=O)OC(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C22H33N3O6/c1-5-29-20(27)15-6-9-17(10-7-15)30-18-11-8-16(14-25-18)19(26)23-12-13-24-21(28)31-22(2,3)4/h8,11,14-15,17H,5-7,9-10,12-13H2,1-4H3,(H,23,26)(H,24,28) |
| InChIKey | PQQCZTHXGFWLSV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|