C18H25FN2O4 — CID 66762365
ethyl 4-[4-(2-aminoethylcarbamoyl)-2-fluorophenoxy]cyclohexane-1-carboxylate (PubChem CID 66762365) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 4-[4-(2-aminoethylcarbamoyl)-2-fluorophenoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[4-(2-aminoethylcarbamoyl)-2-fluorophenoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66762365 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethyl 4-[4-(2-aminoethylcarbamoyl)-2-fluorophenoxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(C(=O)NCCN)cc2F)CC1 |
| InChI | InChI=1S/C18H25FN2O4/c1-2-24-18(23)12-3-6-14(7-4-12)25-16-8-5-13(11-15(16)19)17(22)21-10-9-20/h5,8,11-12,14H,2-4,6-7,9-10,20H2,1H3,(H,21,22) |
| InChIKey | SJKWLOJZVIJLJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |