C25H27ClFNO5 — CID 149400375
4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-2-fluorophenoxy]cyclohexane-1-carboxylic acid (PubChem CID 149400375) has the molecular formula C25H27ClFNO5 and a molecular weight of 475.94 g/mol. Its IUPAC name is 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-2-fluorophenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-2-fluorophenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 149400375 |
| Molecular Formula | C25H27ClFNO5 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-2-fluorophenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NCCCC(=O)c2ccc(OC3CCC(C(=O)O)CC3)c(F)c2)cc1Cl |
| InChI | InChI=1S/C25H27ClFNO5/c1-15-4-5-18(13-20(15)26)24(30)28-12-2-3-22(29)17-8-11-23(21(27)14-17)33-19-9-6-16(7-10-19)25(31)32/h4-5,8,11,13-14,16,19H,2-3,6-7,9-10,12H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | YPGSREAMRUCKHC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|