C26H27NO5S — CID 159072096
4-[4-[4-(1-benzothiophene-5-carbonylamino)butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 159072096) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is 4-[4-[4-(1-benzothiophene-5-carbonylamino)butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-(1-benzothiophene-5-carbonylamino)butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 159072096 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-[4-[4-(1-benzothiophene-5-carbonylamino)butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCNC(=O)c1ccc2sccc2c1)c1ccc(OC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C26H27NO5S/c28-23(2-1-14-27-25(29)20-7-12-24-19(16-20)13-15-33-24)17-3-8-21(9-4-17)32-22-10-5-18(6-11-22)26(30)31/h3-4,7-9,12-13,15-16,18,22H,1-2,5-6,10-11,14H2,(H,27,29)(H,30,31) |
| InChIKey | JZTZNNNMZVMGNC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|