C32H35NO6 — CID 158490997
4-[4-[4-[[4-[(1R)-1-phenylethoxy]benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 158490997) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is 4-[4-[4-[[4-[(1R)-1-phenylethoxy]benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[[4-[(1R)-1-phenylethoxy]benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 158490997 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 4-[4-[4-[[4-[(1R)-1-phenylethoxy]benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H](Oc1ccc(C(=O)NCCCC(=O)c2ccc(OC3CCC(C(=O)O)CC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H35NO6/c1-22(23-6-3-2-4-7-23)38-27-17-11-25(12-18-27)31(35)33-21-5-8-30(34)24-9-15-28(16-10-24)39-29-19-13-26(14-20-29)32(36)37/h2-4,6-7,9-12,15-18,22,26,29H,5,8,13-14,19-21H2,1H3,(H,33,35)(H,36,37)/t22-,26?,29?/m1/s1 |
| InChIKey | HIRQJIHFGSRTEV-NVIUQHBASA-N |
| XLogP | 6.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|