C26H30ClNO5 — CID 159483050
4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-3-methylphenoxy]cyclohexane-1-carboxylic acid (PubChem CID 159483050) has the molecular formula C26H30ClNO5 and a molecular weight of 471.98 g/mol. Its IUPAC name is 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-3-methylphenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-3-methylphenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 159483050 |
| Molecular Formula | C26H30ClNO5 |
| Molecular Weight | 471.98 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[4-[4-[(3-chloro-4-methylbenzoyl)amino]butanoyl]-3-methylphenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NCCCC(=O)c2ccc(OC3CCC(C(=O)O)CC3)cc2C)cc1Cl |
| InChI | InChI=1S/C26H30ClNO5/c1-16-5-6-19(15-23(16)27)25(30)28-13-3-4-24(29)22-12-11-21(14-17(22)2)33-20-9-7-18(8-10-20)26(31)32/h5-6,11-12,14-15,18,20H,3-4,7-10,13H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | LXFWVXCLZZOGHC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|