C29H37N3O5 — CID 152866769
4-[4-[4-[[6-(4-methylpiperidin-1-yl)pyridine-3-carbonyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 152866769) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-[4-[4-[[6-(4-methylpiperidin-1-yl)pyridine-3-carbonyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[[6-(4-methylpiperidin-1-yl)pyridine-3-carbonyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 152866769 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 4-[4-[4-[[6-(4-methylpiperidin-1-yl)pyridine-3-carbonyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCN(c2ccc(C(=O)NCCCC(=O)c3ccc(OC4CCC(C(=O)O)CC4)cc3)cn2)CC1 |
| InChI | InChI=1S/C29H37N3O5/c1-20-14-17-32(18-15-20)27-13-8-23(19-31-27)28(34)30-16-2-3-26(33)21-4-9-24(10-5-21)37-25-11-6-22(7-12-25)29(35)36/h4-5,8-10,13,19-20,22,25H,2-3,6-7,11-12,14-18H2,1H3,(H,30,34)(H,35,36) |
| InChIKey | TYPTXXBEGKMTGH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|