C27H29ClN2O5 — CID 158702688
4-[4-[4-[(3-chloro-1-methylindole-2-carbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 158702688) has the molecular formula C27H29ClN2O5 and a molecular weight of 496.99 g/mol. Its IUPAC name is 4-[4-[4-[(3-chloro-1-methylindole-2-carbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[(3-chloro-1-methylindole-2-carbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 158702688 |
| Molecular Formula | C27H29ClN2O5 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-[4-[4-[(3-chloro-1-methylindole-2-carbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cn1c(C(=O)NCCCC(=O)c2ccc(OC3CCC(C(=O)O)CC3)cc2)c(Cl)c2ccccc21 |
| InChI | InChI=1S/C27H29ClN2O5/c1-30-22-6-3-2-5-21(22)24(28)25(30)26(32)29-16-4-7-23(31)17-8-12-19(13-9-17)35-20-14-10-18(11-15-20)27(33)34/h2-3,5-6,8-9,12-13,18,20H,4,7,10-11,14-16H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | IHSXTJGMZNETMS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|