C30H39NO5 — CID 158863273
ethyl 4-[4-[4-[[4-(2-methylpropyl)benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylate (PubChem CID 158863273) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is ethyl 4-[4-[4-[[4-(2-methylpropyl)benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[4-[4-[[4-(2-methylpropyl)benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 158863273 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | ethyl 4-[4-[4-[[4-(2-methylpropyl)benzoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(C(=O)CCCNC(=O)c3ccc(CC(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H39NO5/c1-4-35-30(34)25-13-17-27(18-14-25)36-26-15-11-23(12-16-26)28(32)6-5-19-31-29(33)24-9-7-22(8-10-24)20-21(2)3/h7-12,15-16,21,25,27H,4-6,13-14,17-20H2,1-3H3,(H,31,33) |
| InChIKey | JAXISKOKRVGMSI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|