C28H34N2O5 — CID 147181891
ethyl 4-[[5-[4-[(4-cyclopropylbenzoyl)amino]butanoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 147181891) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl 4-[[5-[4-[(4-cyclopropylbenzoyl)amino]butanoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[5-[4-[(4-cyclopropylbenzoyl)amino]butanoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 147181891 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | ethyl 4-[[5-[4-[(4-cyclopropylbenzoyl)amino]butanoyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(C(=O)CCCNC(=O)c3ccc(C4CC4)cc3)cn2)CC1 |
| InChI | InChI=1S/C28H34N2O5/c1-2-34-28(33)22-11-14-24(15-12-22)35-26-16-13-23(18-30-26)25(31)4-3-17-29-27(32)21-9-7-20(8-10-21)19-5-6-19/h7-10,13,16,18-19,22,24H,2-6,11-12,14-15,17H2,1H3,(H,29,32) |
| InChIKey | BZTDGXQEHAUMCF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|