C26H32Cl2N2O5 — CID 89020824
ethyl 4-[4-[2-[(3,4-dichloro-3-methylcyclohexa-1,5-diene-1-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylate (PubChem CID 89020824) has the molecular formula C26H32Cl2N2O5 and a molecular weight of 523.46 g/mol. Its IUPAC name is ethyl 4-[4-[2-[(3,4-dichloro-3-methylcyclohexa-1,5-diene-1-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[4-[2-[(3,4-dichloro-3-methylcyclohexa-1,5-diene-1-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89020824 |
| Molecular Formula | C26H32Cl2N2O5 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | ethyl 4-[4-[2-[(3,4-dichloro-3-methylcyclohexa-1,5-diene-1-carbonyl)amino]ethylcarbamoyl]phenoxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(C(=O)NCCNC(=O)C3=CC(C)(Cl)C(Cl)C=C3)cc2)CC1 |
| InChI | InChI=1S/C26H32Cl2N2O5/c1-3-34-25(33)18-6-11-21(12-7-18)35-20-9-4-17(5-10-20)23(31)29-14-15-30-24(32)19-8-13-22(27)26(2,28)16-19/h4-5,8-10,13,16,18,21-22H,3,6-7,11-12,14-15H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | DIPNXQORHTVYOC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|