C26H32N2O5 — CID 162043260
4-[4-[4-[[methyl-(4-methylphenyl)carbamoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 162043260) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[4-[4-[[methyl-(4-methylphenyl)carbamoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[[methyl-(4-methylphenyl)carbamoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162043260 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 4-[4-[4-[[methyl-(4-methylphenyl)carbamoyl]amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(N(C)C(=O)NCCCC(=O)c2ccc(OC3CCC(C(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-18-5-11-21(12-6-18)28(2)26(32)27-17-3-4-24(29)19-7-13-22(14-8-19)33-23-15-9-20(10-16-23)25(30)31/h5-8,11-14,20,23H,3-4,9-10,15-17H2,1-2H3,(H,27,32)(H,30,31) |
| InChIKey | YXODDTAPOMKBTQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|