C28H27ClFNO5 — CID 161438065
4-[4-[4-[(7-chloronaphthalene-2-carbonyl)amino]butanoyl]-3-fluorophenoxy]cyclohexane-1-carboxylic acid (PubChem CID 161438065) has the molecular formula C28H27ClFNO5 and a molecular weight of 511.98 g/mol. Its IUPAC name is 4-[4-[4-[(7-chloronaphthalene-2-carbonyl)amino]butanoyl]-3-fluorophenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[(7-chloronaphthalene-2-carbonyl)amino]butanoyl]-3-fluorophenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 161438065 |
| Molecular Formula | C28H27ClFNO5 |
| Molecular Weight | 511.98 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 4-[4-[4-[(7-chloronaphthalene-2-carbonyl)amino]butanoyl]-3-fluorophenoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCCCC(=O)c1ccc(OC2CCC(C(=O)O)CC2)cc1F)c1ccc2ccc(Cl)cc2c1 |
| InChI | InChI=1S/C28H27ClFNO5/c29-21-8-5-17-3-4-19(14-20(17)15-21)27(33)31-13-1-2-26(32)24-12-11-23(16-25(24)30)36-22-9-6-18(7-10-22)28(34)35/h3-5,8,11-12,14-16,18,22H,1-2,6-7,9-10,13H2,(H,31,33)(H,34,35) |
| InChIKey | VYXILJNNNOWFCS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.98 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|