C27H31NO5 — CID 161083537
4-[4-[4-[(2-phenylcyclopropanecarbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 161083537) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[4-[4-[(2-phenylcyclopropanecarbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[4-[(2-phenylcyclopropanecarbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 161083537 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[4-[4-[(2-phenylcyclopropanecarbonyl)amino]butanoyl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCNC(=O)C1CC1c1ccccc1)c1ccc(OC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C27H31NO5/c29-25(7-4-16-28-26(30)24-17-23(24)18-5-2-1-3-6-18)19-8-12-21(13-9-19)33-22-14-10-20(11-15-22)27(31)32/h1-3,5-6,8-9,12-13,20,22-24H,4,7,10-11,14-17H2,(H,28,30)(H,31,32) |
| InChIKey | UGFGRAUYTKXYOK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|