C32H37N2O6PS — CID 59464366
methyl 5-[(Z)-3-[3-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-2,5-dioxo-1-phosphanylimidazolidin-4-yl]prop-1-enyl]thiophene-2-carboxylate (PubChem CID 59464366) has the molecular formula C32H37N2O6PS and a molecular weight of 608.70 g/mol. Its IUPAC name is methyl 5-[(Z)-3-[3-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-2,5-dioxo-1-phosphanylimidazolidin-4-yl]prop-1-enyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(Z)-3-[3-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-2,5-dioxo-1-phosphanylimidazolidin-4-yl]prop-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59464366 |
| Molecular Formula | C32H37N2O6PS |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | methyl 5-[(Z)-3-[3-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-2,5-dioxo-1-phosphanylimidazolidin-4-yl]prop-1-enyl]thiophene-2-carboxylate |
| SMILES | CCCCCC(OCc1ccc(OC)cc1)c1ccc(N2C(=O)N(P)C(=O)C2C/C=C\c2ccc(C(=O)OC)s2)cc1 |
| InChI | InChI=1S/C32H37N2O6PS/c1-4-5-6-10-28(40-21-22-11-17-25(38-2)18-12-22)23-13-15-24(16-14-23)33-27(30(35)34(41)32(33)37)9-7-8-26-19-20-29(42-26)31(36)39-3/h7-8,11-20,27-28H,4-6,9-10,21,41H2,1-3H3/b8-7- |
| InChIKey | BKWZULCJHXZBQB-FPLPWBNLSA-N |
| XLogP | 7.41 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|