C31H47N2O5PSi — CID 90754499
5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-1-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-3-phosphanylimidazol-2-one (PubChem CID 90754499) has the molecular formula C31H47N2O5PSi and a molecular weight of 586.79 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-1-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-3-phosphanylimidazol-2-one.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-1-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-3-phosphanylimidazol-2-one |
|---|---|
| PubChem CID | 90754499 |
| Molecular Formula | C31H47N2O5PSi |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hydroxy-1-[4-[1-[(4-methoxyphenyl)methoxy]hexyl]phenyl]-3-phosphanylimidazol-2-one |
| SMILES | CCCCCC(OCc1ccc(OC)cc1)c1ccc(-n2c(CCO[Si](C)(C)C(C)(C)C)c(O)n(P)c2=O)cc1 |
| InChI | InChI=1S/C31H47N2O5PSi/c1-8-9-10-11-28(37-22-23-12-18-26(36-5)19-13-23)24-14-16-25(17-15-24)32-27(29(34)33(39)30(32)35)20-21-38-40(6,7)31(2,3)4/h12-19,28,34H,8-11,20-22,39H2,1-7H3 |
| InChIKey | VTQFIPPZPDQAEZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|