C29H34N4O2 — CID 70222580
5-[2-[4-[(1S)-1-[(4-methoxyphenyl)methoxy]octyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 70222580) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 5-[2-[4-[(1S)-1-[(4-methoxyphenyl)methoxy]octyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[(1S)-1-[(4-methoxyphenyl)methoxy]octyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 70222580 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 5-[2-[4-[(1S)-1-[(4-methoxyphenyl)methoxy]octyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCCC[C@H](OCc1ccc(OC)cc1)c1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H34N4O2/c1-3-4-5-6-7-12-28(35-21-22-13-19-25(34-2)20-14-22)24-17-15-23(16-18-24)26-10-8-9-11-27(26)29-30-32-33-31-29/h8-11,13-20,28H,3-7,12,21H2,1-2H3,(H,30,31,32,33)/t28-/m0/s1 |
| InChIKey | OAOGROHAOXRIRS-NDEPHWFRSA-N |
| XLogP | 7.16 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|