C24H27N7S — CID 54527271
3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]octanethial (PubChem CID 54527271) has the molecular formula C24H27N7S and a molecular weight of 445.60 g/mol. Its IUPAC name is 3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]octanethial.
| Compound Name | 3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]octanethial |
|---|---|
| PubChem CID | 54527271 |
| Molecular Formula | C24H27N7S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]octanethial |
| SMILES | CCCCCC(CC=S)c1n[nH]c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C24H27N7S/c1-2-3-4-7-19(14-15-32)23-25-22(26-27-23)16-17-10-12-18(13-11-17)20-8-5-6-9-21(20)24-28-30-31-29-24/h5-6,8-13,15,19H,2-4,7,14,16H2,1H3,(H,25,26,27)(H,28,29,30,31) |
| InChIKey | YTZZGGUEEJUASC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|