C23H25N7S — CID 54390075
4,4-dimethyl-3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentanethial (PubChem CID 54390075) has the molecular formula C23H25N7S and a molecular weight of 431.57 g/mol. Its IUPAC name is 4,4-dimethyl-3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentanethial.
| Compound Name | 4,4-dimethyl-3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentanethial |
|---|---|
| PubChem CID | 54390075 |
| Molecular Formula | C23H25N7S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4,4-dimethyl-3-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]pentanethial |
| SMILES | CC(C)(C)C(CC=S)c1n[nH]c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C23H25N7S/c1-23(2,3)19(12-13-31)22-24-20(25-26-22)14-15-8-10-16(11-9-15)17-6-4-5-7-18(17)21-27-29-30-28-21/h4-11,13,19H,12,14H2,1-3H3,(H,24,25,26)(H,27,28,29,30) |
| InChIKey | VFZVBQUYTVXQHO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|