C27H27N7O — CID 54489031
(3-but-2-ynylcyclohexyl)-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]methanone (PubChem CID 54489031) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is (3-but-2-ynylcyclohexyl)-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]methanone.
| Compound Name | (3-but-2-ynylcyclohexyl)-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 54489031 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (3-but-2-ynylcyclohexyl)-[5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-1,2,4-triazol-3-yl]methanone |
| SMILES | CC#CCC1CCCC(C(=O)c2n[nH]c(Cc3ccc(-c4ccccc4-c4nn[nH]n4)cc3)n2)C1 |
| InChI | InChI=1S/C27H27N7O/c1-2-3-7-18-8-6-9-21(16-18)25(35)27-28-24(29-30-27)17-19-12-14-20(15-13-19)22-10-4-5-11-23(22)26-31-33-34-32-26/h4-5,10-15,18,21H,6-9,16-17H2,1H3,(H,28,29,30)(H,31,32,33,34) |
| InChIKey | XUKSCTNZUDLFRX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|