C27H32N8O — CID 54529279
(3-pentylcyclohexyl)-[1-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]methanone (PubChem CID 54529279) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is (3-pentylcyclohexyl)-[1-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]methanone.
| Compound Name | (3-pentylcyclohexyl)-[1-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 54529279 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (3-pentylcyclohexyl)-[1-[[4-[2-(2H-tetrazol-5-yl)-3-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]methanone |
| SMILES | CCCCCC1CCCC(C(=O)c2ncn(Cc3ccc(-c4cccnc4-c4nn[nH]n4)cc3)n2)C1 |
| InChI | InChI=1S/C27H32N8O/c1-2-3-4-7-19-8-5-9-22(16-19)25(36)27-29-18-35(32-27)17-20-11-13-21(14-12-20)23-10-6-15-28-24(23)26-30-33-34-31-26/h6,10-15,18-19,22H,2-5,7-9,16-17H2,1H3,(H,30,31,33,34) |
| InChIKey | YVIOTVYRGGEUIV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|