C26H27N7 — CID 19904170
5-[2-[4-[(5-but-2-ynyl-3-cyclohexyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19904170) has the molecular formula C26H27N7 and a molecular weight of 437.55 g/mol. Its IUPAC name is 5-[2-[4-[(5-but-2-ynyl-3-cyclohexyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[(5-but-2-ynyl-3-cyclohexyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19904170 |
| Molecular Formula | C26H27N7 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 5-[2-[4-[(5-but-2-ynyl-3-cyclohexyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CC#CCc1nc(C2CCCCC2)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H27N7/c1-2-3-13-24-27-25(21-9-5-4-6-10-21)30-33(24)18-19-14-16-20(17-15-19)22-11-7-8-12-23(22)26-28-31-32-29-26/h7-8,11-12,14-17,21H,4-6,9-10,13,18H2,1H3,(H,28,29,31,32) |
| InChIKey | UFYHNNBXOGAGSG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|