C21H16IrN3O2- — CID 59464597
iridium;2-methyl-3-phenylquinoxaline;pyridine-2-carboxylic acid (PubChem CID 59464597) has the molecular formula C21H16IrN3O2- and a molecular weight of 534.60 g/mol. Its IUPAC name is iridium;2-methyl-3-phenylquinoxaline;pyridine-2-carboxylic acid.
| Compound Name | iridium;2-methyl-3-phenylquinoxaline;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59464597 |
| Molecular Formula | C21H16IrN3O2- |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | iridium;2-methyl-3-phenylquinoxaline;pyridine-2-carboxylic acid |
| SMILES | Cc1nc2ccccc2nc1-c1[c-]cccc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C15H11N2.C6H5NO2.Ir/c1-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16-11;8-6(9)5-3-1-2-4-7-5;/h2-7,9-10H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | YGKIVDNYAIDHON-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|