C28H19F3N3O2Pt- — CID 58389305
2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum;pyridine-2-carboxylic acid (PubChem CID 58389305) has the molecular formula C28H19F3N3O2Pt- and a molecular weight of 681.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum;pyridine-2-carboxylic acid.
| Compound Name | 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58389305 |
| Molecular Formula | C28H19F3N3O2Pt- |
| Molecular Weight | 681.55 g/mol |
| Exact Mass | 681.11 |
| IUPAC Name | 2-(4-methylphenyl)-3-[4-(trifluoromethyl)benzene-6-id-1-yl]quinoxaline;platinum;pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(-c2nc3ccccc3nc2-c2[c-]cc(C(F)(F)F)cc2)cc1.O=C(O)c1ccccn1.[Pt] |
| InChI | InChI=1S/C22H14F3N2.C6H5NO2.Pt/c1-14-6-8-15(9-7-14)20-21(27-19-5-3-2-4-18(19)26-20)16-10-12-17(13-11-16)22(23,24)25;8-6(9)5-3-1-2-4-7-5;/h2-10,12-13H,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | UYHQFHHRXXKGOJ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|