C23H25N5O4S — CID 59465831
4-[4-[(3R)-3-hydroxy-3-phenylpropanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 59465831) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[4-[(3R)-3-hydroxy-3-phenylpropanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[4-[(3R)-3-hydroxy-3-phenylpropanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59465831 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[4-[(3R)-3-hydroxy-3-phenylpropanoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | O=C(C[C@@H](O)c1ccccc1)N1CCN(c2ccc(S(=O)(=O)Nc3ccncn3)cc2)CC1 |
| InChI | InChI=1S/C23H25N5O4S/c29-21(18-4-2-1-3-5-18)16-23(30)28-14-12-27(13-15-28)19-6-8-20(9-7-19)33(31,32)26-22-10-11-24-17-25-22/h1-11,17,21,29H,12-16H2,(H,24,25,26)/t21-/m1/s1 |
| InChIKey | QTJVLWLVQIUJPX-OAQYLSRUSA-N |
| XLogP | 2.05 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |