C22H23FN6O3S — CID 59466309
4-[4-[2-(3-fluoroanilino)acetyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 59466309) has the molecular formula C22H23FN6O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[4-[2-(3-fluoroanilino)acetyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[4-[2-(3-fluoroanilino)acetyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59466309 |
| Molecular Formula | C22H23FN6O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[4-[2-(3-fluoroanilino)acetyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | O=C(CNc1cccc(F)c1)N1CCN(c2ccc(S(=O)(=O)Nc3ccncn3)cc2)CC1 |
| InChI | InChI=1S/C22H23FN6O3S/c23-17-2-1-3-18(14-17)25-15-22(30)29-12-10-28(11-13-29)19-4-6-20(7-5-19)33(31,32)27-21-8-9-24-16-26-21/h1-9,14,16,25H,10-13,15H2,(H,24,26,27) |
| InChIKey | DLIYFTLKICCKJJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |