C23H21FN6O3S — CID 59465878
4-[4-(4-fluoroindole-1-carbonyl)piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 59465878) has the molecular formula C23H21FN6O3S and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[4-(4-fluoroindole-1-carbonyl)piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[4-(4-fluoroindole-1-carbonyl)piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59465878 |
| Molecular Formula | C23H21FN6O3S |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-[4-(4-fluoroindole-1-carbonyl)piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | O=C(N1CCN(c2ccc(S(=O)(=O)Nc3ccncn3)cc2)CC1)n1ccc2c(F)cccc21 |
| InChI | InChI=1S/C23H21FN6O3S/c24-20-2-1-3-21-19(20)9-11-30(21)23(31)29-14-12-28(13-15-29)17-4-6-18(7-5-17)34(32,33)27-22-8-10-25-16-26-22/h1-11,16H,12-15H2,(H,25,26,27) |
| InChIKey | XNCXRZYSRVJLSY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |