C25H27FN6O3S — CID 158125222
4-[4-[2-(4-fluoroindol-1-yl)prop-2-enoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide;molecular hydrogen (PubChem CID 158125222) has the molecular formula C25H27FN6O3S and a molecular weight of 510.60 g/mol. Its IUPAC name is 4-[4-[2-(4-fluoroindol-1-yl)prop-2-enoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide;molecular hydrogen.
| Compound Name | 4-[4-[2-(4-fluoroindol-1-yl)prop-2-enoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 158125222 |
| Molecular Formula | C25H27FN6O3S |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[4-[2-(4-fluoroindol-1-yl)prop-2-enoyl]piperazin-1-yl]-N-pyrimidin-4-ylbenzenesulfonamide;molecular hydrogen |
| SMILES | C=C(C(=O)N1CCN(c2ccc(S(=O)(=O)Nc3ccncn3)cc2)CC1)n1ccc2c(F)cccc21.[H][H].[H][H] |
| InChI | InChI=1S/C25H23FN6O3S.2H2/c1-18(32-12-10-21-22(26)3-2-4-23(21)32)25(33)31-15-13-30(14-16-31)19-5-7-20(8-6-19)36(34,35)29-24-9-11-27-17-28-24;;/h2-12,17H,1,13-16H2,(H,27,28,29);2*1H |
| InChIKey | FSBVIWJVOJQHIV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|