C20H18Cl2N4O3S2 — CID 59465879
4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 59465879) has the molecular formula C20H18Cl2N4O3S2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59465879 |
| Molecular Formula | C20H18Cl2N4O3S2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 4-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCN(c2ccc(S(=O)(=O)Nc3nccs3)cc2)CC1 |
| InChI | InChI=1S/C20H18Cl2N4O3S2/c21-14-1-6-17(18(22)13-14)19(27)26-10-8-25(9-11-26)15-2-4-16(5-3-15)31(28,29)24-20-23-7-12-30-20/h1-7,12-13H,8-11H2,(H,23,24) |
| InChIKey | IWARZPCMUIYMHA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |