C19H21IO7 — CID 59466968
(4S,6E,9R,10S,12E)-9,10,18-trihydroxy-7-iodo-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 59466968) has the molecular formula C19H21IO7 and a molecular weight of 488.27 g/mol. Its IUPAC name is (4S,6E,9R,10S,12E)-9,10,18-trihydroxy-7-iodo-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,6E,9R,10S,12E)-9,10,18-trihydroxy-7-iodo-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 59466968 |
| Molecular Formula | C19H21IO7 |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | (4S,6E,9R,10S,12E)-9,10,18-trihydroxy-7-iodo-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@@H](O)C(=O)/C(I)=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H21IO7/c1-10-6-7-13(20)17(23)18(24)14(21)5-3-4-11-8-12(26-2)9-15(22)16(11)19(25)27-10/h3-4,7-10,14,18,21-22,24H,5-6H2,1-2H3/b4-3+,13-7+/t10-,14-,18+/m0/s1 |
| InChIKey | YOSUIVRXCGKYEX-PYIGCAHWSA-N |
| XLogP | 2.36 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|