C16H15FO7 — CID 46882178
(4Z,7R,8R,10E)-5-fluoro-7,8,16-trihydroxy-14-methoxy-3-oxabicyclo[10.4.0]hexadeca-1(12),4,10,13,15-pentaene-2,6-dione (PubChem CID 46882178) has the molecular formula C16H15FO7 and a molecular weight of 338.29 g/mol. Its IUPAC name is (4Z,7R,8R,10E)-5-fluoro-7,8,16-trihydroxy-14-methoxy-3-oxabicyclo[10.4.0]hexadeca-1(12),4,10,13,15-pentaene-2,6-dione.
| Compound Name | (4Z,7R,8R,10E)-5-fluoro-7,8,16-trihydroxy-14-methoxy-3-oxabicyclo[10.4.0]hexadeca-1(12),4,10,13,15-pentaene-2,6-dione |
|---|---|
| PubChem CID | 46882178 |
| Molecular Formula | C16H15FO7 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (4Z,7R,8R,10E)-5-fluoro-7,8,16-trihydroxy-14-methoxy-3-oxabicyclo[10.4.0]hexadeca-1(12),4,10,13,15-pentaene-2,6-dione |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@@H](O)[C@@H](O)C(=O)/C(F)=C/OC2=O |
| InChI | InChI=1S/C16H15FO7/c1-23-9-5-8-3-2-4-11(18)15(21)14(20)10(17)7-24-16(22)13(8)12(19)6-9/h2-3,5-7,11,15,18-19,21H,4H2,1H3/b3-2+,10-7-/t11-,15-/m1/s1 |
| InChIKey | IMOBDMOEKOBTBM-CONFRVSISA-N |
| XLogP | 1.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |