C21H24O7 — CID 59467249
(8R,9Z,12R,13R,15E)-12,13,21-trihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione (PubChem CID 59467249) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (8R,9Z,12R,13R,15E)-12,13,21-trihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione.
| Compound Name | (8R,9Z,12R,13R,15E)-12,13,21-trihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione |
|---|---|
| PubChem CID | 59467249 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (8R,9Z,12R,13R,15E)-12,13,21-trihydroxy-19-methoxy-3-oxatricyclo[15.4.0.04,8]henicosa-1(17),9,15,18,20-pentaene-2,11-dione |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@@H](O)[C@@H](O)C(=O)/C=C\[C@H]1CCCC1OC2=O |
| InChI | InChI=1S/C21H24O7/c1-27-14-10-13-5-2-6-15(22)20(25)16(23)9-8-12-4-3-7-18(12)28-21(26)19(13)17(24)11-14/h2,5,8-12,15,18,20,22,24-25H,3-4,6-7H2,1H3/b5-2+,9-8-/t12-,15-,18?,20-/m1/s1 |
| InChIKey | QKIMHGVNYKGHRA-AUMHXMJYSA-N |
| XLogP | 1.99 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |