C24H27N5O3S — CID 59468445
5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxamide (PubChem CID 59468445) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxamide.
| Compound Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59468445 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxamide |
| SMILES | CC(O)c1cccc(Nc2nccc(-c3ccc(C(=O)NCCCN4CCCC4=O)s3)n2)c1 |
| InChI | InChI=1S/C24H27N5O3S/c1-16(30)17-5-2-6-18(15-17)27-24-26-12-10-19(28-24)20-8-9-21(33-20)23(32)25-11-4-14-29-13-3-7-22(29)31/h2,5-6,8-10,12,15-16,30H,3-4,7,11,13-14H2,1H3,(H,25,32)(H,26,27,28) |
| InChIKey | LDOXFOXBTJICIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|