C20H18N4O2S — CID 59468538
5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-prop-2-ynylthiophene-2-carboxamide (PubChem CID 59468538) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-prop-2-ynylthiophene-2-carboxamide.
| Compound Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-prop-2-ynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 59468538 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 5-[2-[3-(1-hydroxyethyl)anilino]pyrimidin-4-yl]-N-prop-2-ynylthiophene-2-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(-c2ccnc(Nc3cccc(C(C)O)c3)n2)s1 |
| InChI | InChI=1S/C20H18N4O2S/c1-3-10-21-19(26)18-8-7-17(27-18)16-9-11-22-20(24-16)23-15-6-4-5-14(12-15)13(2)25/h1,4-9,11-13,25H,10H2,2H3,(H,21,26)(H,22,23,24) |
| InChIKey | BCFTZRYWFDVKFP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|