C18H17N5O3S — CID 69244644
[3-[1-[[5-(2-aminopyrimidin-4-yl)thiophene-2-carbonyl]amino]ethyl]phenyl]carbamic acid (PubChem CID 69244644) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is [3-[1-[[5-(2-aminopyrimidin-4-yl)thiophene-2-carbonyl]amino]ethyl]phenyl]carbamic acid.
| Compound Name | [3-[1-[[5-(2-aminopyrimidin-4-yl)thiophene-2-carbonyl]amino]ethyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 69244644 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [3-[1-[[5-(2-aminopyrimidin-4-yl)thiophene-2-carbonyl]amino]ethyl]phenyl]carbamic acid |
| SMILES | CC(NC(=O)c1ccc(-c2ccnc(N)n2)s1)c1cccc(NC(=O)O)c1 |
| InChI | InChI=1S/C18H17N5O3S/c1-10(11-3-2-4-12(9-11)22-18(25)26)21-16(24)15-6-5-14(27-15)13-7-8-20-17(19)23-13/h2-10,22H,1H3,(H,21,24)(H,25,26)(H2,19,20,23) |
| InChIKey | YICTXBJBJARVKF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |