C19H19ClN4O2S — CID 59856946
5-(2-aminopyrimidin-4-yl)-N-[2-(4-chlorophenyl)-4-hydroxybutyl]thiophene-2-carboxamide (PubChem CID 59856946) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-N-[2-(4-chlorophenyl)-4-hydroxybutyl]thiophene-2-carboxamide.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-N-[2-(4-chlorophenyl)-4-hydroxybutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59856946 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-N-[2-(4-chlorophenyl)-4-hydroxybutyl]thiophene-2-carboxamide |
| SMILES | Nc1nccc(-c2ccc(C(=O)NCC(CCO)c3ccc(Cl)cc3)s2)n1 |
| InChI | InChI=1S/C19H19ClN4O2S/c20-14-3-1-12(2-4-14)13(8-10-25)11-23-18(26)17-6-5-16(27-17)15-7-9-22-19(21)24-15/h1-7,9,13,25H,8,10-11H2,(H,23,26)(H2,21,22,24) |
| InChIKey | CCEPHYALMZPCAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |