C13H9ClN4S — CID 1476734
4-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 1476734) has the molecular formula C13H9ClN4S and a molecular weight of 288.76 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 1476734 |
| Molecular Formula | C13H9ClN4S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2cnc(-c3ccc(Cl)cc3)s2)n1 |
| InChI | InChI=1S/C13H9ClN4S/c14-9-3-1-8(2-4-9)12-17-7-11(19-12)10-5-6-16-13(15)18-10/h1-7H,(H2,15,16,18) |
| InChIKey | FXJZXBADVLMAOX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |